C32H34Br2N2 — CID 166131871
4-[[4-[bis(prop-2-enyl)amino]-2-bromophenyl]-(2-methylphenyl)methyl]-3-bromo-N,N-bis(prop-2-enyl)aniline (PubChem CID 166131871) has the molecular formula C32H34Br2N2 and a molecular weight of 606.45 g/mol. Its IUPAC name is 4-[[4-[bis(prop-2-enyl)amino]-2-bromophenyl]-(2-methylphenyl)methyl]-3-bromo-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 4-[[4-[bis(prop-2-enyl)amino]-2-bromophenyl]-(2-methylphenyl)methyl]-3-bromo-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 166131871 |
| Molecular Formula | C32H34Br2N2 |
| Molecular Weight | 606.45 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | 4-[[4-[bis(prop-2-enyl)amino]-2-bromophenyl]-(2-methylphenyl)methyl]-3-bromo-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1ccc(C(c2ccccc2C)c2ccc(N(CC=C)CC=C)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C32H34Br2N2/c1-6-18-35(19-7-2)25-14-16-28(30(33)22-25)32(27-13-11-10-12-24(27)5)29-17-15-26(23-31(29)34)36(20-8-3)21-9-4/h6-17,22-23,32H,1-4,18-21H2,5H3 |
| InChIKey | GTUFZVBEYHZSRG-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.45 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|