C21H20Br2N2O2 — CID 166131884
4-[(4-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methyl]-3-bromoaniline (PubChem CID 166131884) has the molecular formula C21H20Br2N2O2 and a molecular weight of 492.21 g/mol. Its IUPAC name is 4-[(4-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methyl]-3-bromoaniline.
| Compound Name | 4-[(4-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methyl]-3-bromoaniline |
|---|---|
| PubChem CID | 166131884 |
| Molecular Formula | C21H20Br2N2O2 |
| Molecular Weight | 492.21 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 4-[(4-amino-2-bromophenyl)-(2,6-dimethoxyphenyl)methyl]-3-bromoaniline |
| SMILES | COc1cccc(OC)c1C(c1ccc(N)cc1Br)c1ccc(N)cc1Br |
| InChI | InChI=1S/C21H20Br2N2O2/c1-26-18-4-3-5-19(27-2)21(18)20(14-8-6-12(24)10-16(14)22)15-9-7-13(25)11-17(15)23/h3-11,20H,24-25H2,1-2H3 |
| InChIKey | RPNIWXZZHDFBMZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.21 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|