C42H42N4O4 — CID 146642834
4-[(4-amino-2-methoxyphenyl)-[4-[4-[bis(4-amino-2-methoxyphenyl)methyl]phenyl]phenyl]methyl]-3-methoxyaniline (PubChem CID 146642834) has the molecular formula C42H42N4O4 and a molecular weight of 666.82 g/mol. Its IUPAC name is 4-[(4-amino-2-methoxyphenyl)-[4-[4-[bis(4-amino-2-methoxyphenyl)methyl]phenyl]phenyl]methyl]-3-methoxyaniline.
| Compound Name | 4-[(4-amino-2-methoxyphenyl)-[4-[4-[bis(4-amino-2-methoxyphenyl)methyl]phenyl]phenyl]methyl]-3-methoxyaniline |
|---|---|
| PubChem CID | 146642834 |
| Molecular Formula | C42H42N4O4 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | 4-[(4-amino-2-methoxyphenyl)-[4-[4-[bis(4-amino-2-methoxyphenyl)methyl]phenyl]phenyl]methyl]-3-methoxyaniline |
| SMILES | COc1cc(N)ccc1C(c1ccc(-c2ccc(C(c3ccc(N)cc3OC)c3ccc(N)cc3OC)cc2)cc1)c1ccc(N)cc1OC |
| InChI | InChI=1S/C42H42N4O4/c1-47-37-21-29(43)13-17-33(37)41(34-18-14-30(44)22-38(34)48-2)27-9-5-25(6-10-27)26-7-11-28(12-8-26)42(35-19-15-31(45)23-39(35)49-3)36-20-16-32(46)24-40(36)50-4/h5-24,41-42H,43-46H2,1-4H3 |
| InChIKey | XHVRJRBFAFAOIT-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|