C38H36O2 — CID 171403470
2-[4-[(2,4-dimethoxyphenyl)-(4-methylphenyl)methyl]phenyl]-7,9,9-trimethylfluorene (PubChem CID 171403470) has the molecular formula C38H36O2 and a molecular weight of 524.70 g/mol. Its IUPAC name is 2-[4-[(2,4-dimethoxyphenyl)-(4-methylphenyl)methyl]phenyl]-7,9,9-trimethylfluorene.
| Compound Name | 2-[4-[(2,4-dimethoxyphenyl)-(4-methylphenyl)methyl]phenyl]-7,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 171403470 |
| Molecular Formula | C38H36O2 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 2-[4-[(2,4-dimethoxyphenyl)-(4-methylphenyl)methyl]phenyl]-7,9,9-trimethylfluorene |
| SMILES | COc1ccc(C(c2ccc(C)cc2)c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(C)ccc3-4)cc2)c(OC)c1 |
| InChI | InChI=1S/C38H36O2/c1-24-7-10-27(11-8-24)37(33-20-17-30(39-5)23-36(33)40-6)28-14-12-26(13-15-28)29-16-19-32-31-18-9-25(2)21-34(31)38(3,4)35(32)22-29/h7-23,37H,1-6H3 |
| InChIKey | AGWJDYIOTSEKHC-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|