C10H8Cl2F2O3 — CID 166132525
methyl 2-(3,6-dichloro-2-methoxyphenyl)-2,2-difluoroacetate (PubChem CID 166132525) has the molecular formula C10H8Cl2F2O3 and a molecular weight of 285.07 g/mol. Its IUPAC name is methyl 2-(3,6-dichloro-2-methoxyphenyl)-2,2-difluoroacetate.
| Compound Name | methyl 2-(3,6-dichloro-2-methoxyphenyl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 166132525 |
| Molecular Formula | C10H8Cl2F2O3 |
| Molecular Weight | 285.07 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | methyl 2-(3,6-dichloro-2-methoxyphenyl)-2,2-difluoroacetate |
| SMILES | COC(=O)C(F)(F)c1c(Cl)ccc(Cl)c1OC |
| InChI | InChI=1S/C10H8Cl2F2O3/c1-16-8-6(12)4-3-5(11)7(8)10(13,14)9(15)17-2/h3-4H,1-2H3 |
| InChIKey | IEBCSCNCTLFPHQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.07 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |