C16H8Cl2F2N2O2 — CID 166139075
6,8-dichloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)quinolin-2-amine (PubChem CID 166139075) has the molecular formula C16H8Cl2F2N2O2 and a molecular weight of 369.15 g/mol. Its IUPAC name is 6,8-dichloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)quinolin-2-amine.
| Compound Name | 6,8-dichloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 166139075 |
| Molecular Formula | C16H8Cl2F2N2O2 |
| Molecular Weight | 369.15 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 6,8-dichloro-N-(2,2-difluoro-1,3-benzodioxol-5-yl)quinolin-2-amine |
| SMILES | FC1(F)Oc2ccc(Nc3ccc4cc(Cl)cc(Cl)c4n3)cc2O1 |
| InChI | InChI=1S/C16H8Cl2F2N2O2/c17-9-5-8-1-4-14(22-15(8)11(18)6-9)21-10-2-3-12-13(7-10)24-16(19,20)23-12/h1-7H,(H,21,22) |
| InChIKey | RCIGEQXKNYPNBJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.15 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |