C18H27ClN2O3 — CID 166141538
tert-butyl (2R,5S)-2-(2-amino-3-chlorophenyl)-5-propan-2-ylmorpholine-4-carboxylate (PubChem CID 166141538) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is tert-butyl (2R,5S)-2-(2-amino-3-chlorophenyl)-5-propan-2-ylmorpholine-4-carboxylate.
| Compound Name | tert-butyl (2R,5S)-2-(2-amino-3-chlorophenyl)-5-propan-2-ylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 166141538 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl (2R,5S)-2-(2-amino-3-chlorophenyl)-5-propan-2-ylmorpholine-4-carboxylate |
| SMILES | CC(C)[C@H]1CO[C@H](c2cccc(Cl)c2N)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27ClN2O3/c1-11(2)14-10-23-15(12-7-6-8-13(19)16(12)20)9-21(14)17(22)24-18(3,4)5/h6-8,11,14-15H,9-10,20H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | RSRUYPWVXVROGH-CABCVRRESA-N |
| XLogP | 4.26 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|