About N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide
N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 166144244) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide.
Molecular Properties
| Compound Name | N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide |
| PubChem CID | 166144244 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | CCN1CCC2(CCN(C(=O)N(C)CC)CC2)C1 |
| InChI | InChI=1S/C14H27N3O/c1-4-15(3)13(18)17-10-7-14(8-11-17)6-9-16(5-2)12-14/h4-12H2,1-3H3 |
| InChIKey | BEBOXPQDROBTEJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide?
The IUPAC name of N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide (CID 166144244) is N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide.
What is the SMILES notation for N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide?
The canonical SMILES for N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide is CCN1CCC2(CCN(C(=O)N(C)CC)CC2)C1.
What is the InChIKey of N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide?
The InChIKey is BEBOXPQDROBTEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O/c1-4-15(3)13(18)17-10-7-14(8-11-17)6-9-16(5-2)12-14/h4-12H2,1-3H3.
What are the key properties of N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide?
N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide has a molecular weight of 253.39 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-diethyl-N-methyl-2,8-diazaspiro[4.5]decane-8-carboxamide is sourced from PubChem (CID 166144244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).