C21H22N4O2 — CID 166156169
methane;7-morpholin-4-yl-5-(3-phenylpyrazol-1-yl)furo[3,2-b]pyridine (PubChem CID 166156169) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is methane;7-morpholin-4-yl-5-(3-phenylpyrazol-1-yl)furo[3,2-b]pyridine.
| Compound Name | methane;7-morpholin-4-yl-5-(3-phenylpyrazol-1-yl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 166156169 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | methane;7-morpholin-4-yl-5-(3-phenylpyrazol-1-yl)furo[3,2-b]pyridine |
| SMILES | C.c1ccc(-c2ccn(-c3cc(N4CCOCC4)c4occc4n3)n2)cc1 |
| InChI | InChI=1S/C20H18N4O2.CH4/c1-2-4-15(5-3-1)16-6-8-24(22-16)19-14-18(23-9-12-25-13-10-23)20-17(21-19)7-11-26-20;/h1-8,11,14H,9-10,12-13H2;1H4 |
| InChIKey | MMXWIWRITMHKBY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |