C14H16F2N2 — CID 166158171
6,7-difluoro-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole (PubChem CID 166158171) has the molecular formula C14H16F2N2 and a molecular weight of 250.29 g/mol. Its IUPAC name is 6,7-difluoro-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole.
| Compound Name | 6,7-difluoro-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 166158171 |
| Molecular Formula | C14H16F2N2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 6,7-difluoro-3-[(1-methylpyrrolidin-2-yl)methyl]-1H-indole |
| SMILES | CN1CCCC1Cc1c[nH]c2c(F)c(F)ccc12 |
| InChI | InChI=1S/C14H16F2N2/c1-18-6-2-3-10(18)7-9-8-17-14-11(9)4-5-12(15)13(14)16/h4-5,8,10,17H,2-3,6-7H2,1H3 |
| InChIKey | OCWPRMQLZGBBNV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |