C27H31N3O3 — CID 166160608
tert-butyl N-[[4-(benzhydrylideneamino)-2-pyridinyl]methyl]-N-(2-methoxyethyl)carbamate (PubChem CID 166160608) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl N-[[4-(benzhydrylideneamino)-2-pyridinyl]methyl]-N-(2-methoxyethyl)carbamate.
| Compound Name | tert-butyl N-[[4-(benzhydrylideneamino)-2-pyridinyl]methyl]-N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 166160608 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | tert-butyl N-[[4-(benzhydrylideneamino)-2-pyridinyl]methyl]-N-(2-methoxyethyl)carbamate |
| SMILES | COCCN(Cc1cc(N=C(c2ccccc2)c2ccccc2)ccn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H31N3O3/c1-27(2,3)33-26(31)30(17-18-32-4)20-24-19-23(15-16-28-24)29-25(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-16,19H,17-18,20H2,1-4H3 |
| InChIKey | ZGIZRMGRCOVTPX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|