C23H31N3O3 — CID 90374985
tert-butyl N-[3-[benzyl(methyl)amino]propyl]-N-[(4-formyl-2-pyridinyl)methyl]carbamate (PubChem CID 90374985) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is tert-butyl N-[3-[benzyl(methyl)amino]propyl]-N-[(4-formyl-2-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-[3-[benzyl(methyl)amino]propyl]-N-[(4-formyl-2-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 90374985 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | tert-butyl N-[3-[benzyl(methyl)amino]propyl]-N-[(4-formyl-2-pyridinyl)methyl]carbamate |
| SMILES | CN(CCCN(Cc1cc(C=O)ccn1)C(=O)OC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C23H31N3O3/c1-23(2,3)29-22(28)26(17-21-15-20(18-27)11-12-24-21)14-8-13-25(4)16-19-9-6-5-7-10-19/h5-7,9-12,15,18H,8,13-14,16-17H2,1-4H3 |
| InChIKey | IEKJYZJEGGAZDN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|