C14H21N2S+ — CID 166161498
2-(1,1-dimethylpiperidin-1-ium-4-yl)-6,7-dihydro-1,3-benzothiazole (PubChem CID 166161498) has the molecular formula C14H21N2S+ and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-(1,1-dimethylpiperidin-1-ium-4-yl)-6,7-dihydro-1,3-benzothiazole.
| Compound Name | 2-(1,1-dimethylpiperidin-1-ium-4-yl)-6,7-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 166161498 |
| Molecular Formula | C14H21N2S+ |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-(1,1-dimethylpiperidin-1-ium-4-yl)-6,7-dihydro-1,3-benzothiazole |
| SMILES | C[N+]1(C)CCC(c2nc3c(s2)CCC=C3)CC1 |
| InChI | InChI=1S/C14H21N2S/c1-16(2)9-7-11(8-10-16)14-15-12-5-3-4-6-13(12)17-14/h3,5,11H,4,6-10H2,1-2H3/q+1 |
| InChIKey | HNJUEVBHRBKEME-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|