C19H32N2S — CID 143563679
ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-1,3-benzothiazol-2-amine (PubChem CID 143563679) has the molecular formula C19H32N2S and a molecular weight of 320.55 g/mol. Its IUPAC name is ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-1,3-benzothiazol-2-amine.
| Compound Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 143563679 |
| Molecular Formula | C19H32N2S |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | ethane;N-[(3E)-hexa-1,3,5-trien-3-yl]-6,7-dihydro-1,3-benzothiazol-2-amine |
| SMILES | C=C/C=C(\C=C)Nc1nc2c(s1)CCC=C2.CC.CC.CC |
| InChI | InChI=1S/C13H14N2S.3C2H6/c1-3-7-10(4-2)14-13-15-11-8-5-6-9-12(11)16-13;3*1-2/h3-5,7-8H,1-2,6,9H2,(H,14,15);3*1-2H3/b10-7+;;; |
| InChIKey | FRSLHKGFSSYJJX-ICWQEWPPSA-N |
| XLogP | 6.85 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|