About CID 166164406
CID 166164406 (PubChem CID 166164406) has the molecular formula C20H31BN3O
and a molecular weight of 340.30 g/mol.
Molecular Properties
| Compound Name | CID 166164406 |
| PubChem CID | 166164406 |
| Molecular Formula | C20H31BN3O |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | — |
| SMILES | CCCCCC(CCC)C1=Cc2nc(C)nc(N3CCOCC3)c2[B]1 |
| InChI | InChI=1S/C20H31BN3O/c1-4-6-7-9-16(8-5-2)17-14-18-19(21-17)20(23-15(3)22-18)24-10-12-25-13-11-24/h14,16H,4-13H2,1-3H3 |
| InChIKey | INUGUIYPYUJEHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166164406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166164406?
The IUPAC name of CID 166164406 (CID 166164406) is not available.
What is the SMILES notation for CID 166164406?
The canonical SMILES for CID 166164406 is CCCCCC(CCC)C1=Cc2nc(C)nc(N3CCOCC3)c2[B]1.
What is the InChIKey of CID 166164406?
The InChIKey is INUGUIYPYUJEHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31BN3O/c1-4-6-7-9-16(8-5-2)17-14-18-19(21-17)20(23-15(3)22-18)24-10-12-25-13-11-24/h14,16H,4-13H2,1-3H3.
What are the key properties of CID 166164406?
CID 166164406 has a molecular weight of 340.30 g/mol, XLogP of 3.30, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166164406 is sourced from PubChem (CID 166164406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).