C9H15NO5 — CID 166165556
methyl (2S)-2-[[2-(oxiran-2-ylmethoxy)acetyl]amino]propanoate (PubChem CID 166165556) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(oxiran-2-ylmethoxy)acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[2-(oxiran-2-ylmethoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 166165556 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | methyl (2S)-2-[[2-(oxiran-2-ylmethoxy)acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)COCC1CO1 |
| InChI | InChI=1S/C9H15NO5/c1-6(9(12)13-2)10-8(11)5-14-3-7-4-15-7/h6-7H,3-5H2,1-2H3,(H,10,11)/t6-,7?/m0/s1 |
| InChIKey | HBXCASQJZMPASX-PKPIPKONSA-N |
| XLogP | -0.92 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|