C19H19BrClN3O3 — CID 166167845
benzyl N-[1-(5-bromo-2-chloro-3-formyl-4-pyridinyl)piperidin-4-yl]carbamate (PubChem CID 166167845) has the molecular formula C19H19BrClN3O3 and a molecular weight of 452.74 g/mol. Its IUPAC name is benzyl N-[1-(5-bromo-2-chloro-3-formyl-4-pyridinyl)piperidin-4-yl]carbamate.
| Compound Name | benzyl N-[1-(5-bromo-2-chloro-3-formyl-4-pyridinyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 166167845 |
| Molecular Formula | C19H19BrClN3O3 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | benzyl N-[1-(5-bromo-2-chloro-3-formyl-4-pyridinyl)piperidin-4-yl]carbamate |
| SMILES | O=Cc1c(Cl)ncc(Br)c1N1CCC(NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H19BrClN3O3/c20-16-10-22-18(21)15(11-25)17(16)24-8-6-14(7-9-24)23-19(26)27-12-13-4-2-1-3-5-13/h1-5,10-11,14H,6-9,12H2,(H,23,26) |
| InChIKey | FUDXBBMSUSGESS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|