C24H24N2O4 — CID 166174320
4-[(E)-2-(4-methoxyphenyl)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hept-1-enyl]benzonitrile (PubChem CID 166174320) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-[(E)-2-(4-methoxyphenyl)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hept-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-2-(4-methoxyphenyl)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hept-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 166174320 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-[(E)-2-(4-methoxyphenyl)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)hept-1-enyl]benzonitrile |
| SMILES | CCCCC(=O)/C(=C(\c1ccc(C#N)cc1)N1CCOC1=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-3-4-5-21(27)22(18-10-12-20(29-2)13-11-18)23(26-14-15-30-24(26)28)19-8-6-17(16-25)7-9-19/h6-13H,3-5,14-15H2,1-2H3/b23-22+ |
| InChIKey | WIZYDNMHMDHUOC-GHVJWSGMSA-N |
| XLogP | 4.65 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|