C24H25N3O3 — CID 166186603
3'-[[3-(piperidine-1-carbonyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 166186603) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 3'-[[3-(piperidine-1-carbonyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 3'-[[3-(piperidine-1-carbonyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 166186603 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3'-[[3-(piperidine-1-carbonyl)phenyl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C(c1cccc(CN2C(=O)NC3(CCc4ccccc43)C2=O)c1)N1CCCCC1 |
| InChI | InChI=1S/C24H25N3O3/c28-21(26-13-4-1-5-14-26)19-9-6-7-17(15-19)16-27-22(29)24(25-23(27)30)12-11-18-8-2-3-10-20(18)24/h2-3,6-10,15H,1,4-5,11-14,16H2,(H,25,30) |
| InChIKey | KDODJHJLEURTEW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|