C25H20FN3O4 — CID 166187473
methyl 2-(4-fluorophenoxy)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]propanoate (PubChem CID 166187473) has the molecular formula C25H20FN3O4 and a molecular weight of 445.45 g/mol. Its IUPAC name is methyl 2-(4-fluorophenoxy)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]propanoate.
| Compound Name | methyl 2-(4-fluorophenoxy)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 166187473 |
| Molecular Formula | C25H20FN3O4 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | methyl 2-(4-fluorophenoxy)-3-[(2-pyridin-2-ylquinoline-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(CNC(=O)c1cc(-c2ccccn2)nc2ccccc12)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C25H20FN3O4/c1-32-25(31)23(33-17-11-9-16(26)10-12-17)15-28-24(30)19-14-22(21-8-4-5-13-27-21)29-20-7-3-2-6-18(19)20/h2-14,23H,15H2,1H3,(H,28,30) |
| InChIKey | BSMGWAZSZQWBGB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |