C22H21N5O3 — CID 166191015
2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one (PubChem CID 166191015) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one.
| Compound Name | 2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one |
|---|---|
| PubChem CID | 166191015 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)-1,3,4,8,9,9a-hexahydropyrazino[1,2-c][1,3]oxazin-6-one |
| SMILES | O=C(c1nc(-c2ccccc2)n(-c2ccccc2)n1)N1CCN2C(=O)OCCC2C1 |
| InChI | InChI=1S/C22H21N5O3/c28-21(25-12-13-26-18(15-25)11-14-30-22(26)29)19-23-20(16-7-3-1-4-8-16)27(24-19)17-9-5-2-6-10-17/h1-10,18H,11-15H2 |
| InChIKey | WBKHZTTZWFJWEI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |