C25H24N6O4 — CID 55833378
1-[2-[4-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 55833378) has the molecular formula C25H24N6O4 and a molecular weight of 472.51 g/mol. Its IUPAC name is 1-[2-[4-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55833378 |
| Molecular Formula | C25H24N6O4 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 1-[2-[4-(1,5-diphenyl-1,2,4-triazole-3-carbonyl)piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(CN1C(=O)CCC1=O)N1CCN(C(=O)c2nc(-c3ccccc3)n(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C25H24N6O4/c32-20-11-12-21(33)30(20)17-22(34)28-13-15-29(16-14-28)25(35)23-26-24(18-7-3-1-4-8-18)31(27-23)19-9-5-2-6-10-19/h1-10H,11-17H2 |
| InChIKey | DMYCXCIVSKYENC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 108.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|