C23H22N4O2 — CID 166198748
N-[4-(2-imidazol-1-ylethoxy)phenyl]-2,7-dimethylquinoline-3-carboxamide (PubChem CID 166198748) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[4-(2-imidazol-1-ylethoxy)phenyl]-2,7-dimethylquinoline-3-carboxamide.
| Compound Name | N-[4-(2-imidazol-1-ylethoxy)phenyl]-2,7-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 166198748 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[4-(2-imidazol-1-ylethoxy)phenyl]-2,7-dimethylquinoline-3-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)Nc3ccc(OCCn4ccnc4)cc3)c(C)nc2c1 |
| InChI | InChI=1S/C23H22N4O2/c1-16-3-4-18-14-21(17(2)25-22(18)13-16)23(28)26-19-5-7-20(8-6-19)29-12-11-27-10-9-24-15-27/h3-10,13-15H,11-12H2,1-2H3,(H,26,28) |
| InChIKey | UVYCFZNBAOMXET-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |