C13H17N3O4S — CID 166200624
5-[2-(2-methylpropyl)-3-oxopiperazin-1-yl]sulfonylfuran-2-carbonitrile (PubChem CID 166200624) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-[2-(2-methylpropyl)-3-oxopiperazin-1-yl]sulfonylfuran-2-carbonitrile.
| Compound Name | 5-[2-(2-methylpropyl)-3-oxopiperazin-1-yl]sulfonylfuran-2-carbonitrile |
|---|---|
| PubChem CID | 166200624 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-[2-(2-methylpropyl)-3-oxopiperazin-1-yl]sulfonylfuran-2-carbonitrile |
| SMILES | CC(C)CC1C(=O)NCCN1S(=O)(=O)c1ccc(C#N)o1 |
| InChI | InChI=1S/C13H17N3O4S/c1-9(2)7-11-13(17)15-5-6-16(11)21(18,19)12-4-3-10(8-14)20-12/h3-4,9,11H,5-7H2,1-2H3,(H,15,17) |
| InChIKey | PXGNRMQHARNTKY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |