C18H18F3N7O3 — CID 166208546
1-[1-[3-[4-[(dimethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,2,4-triazole-3-carbonitrile;2,2,2-trifluoroacetic acid (PubChem CID 166208546) has the molecular formula C18H18F3N7O3 and a molecular weight of 437.38 g/mol. Its IUPAC name is 1-[1-[3-[4-[(dimethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,2,4-triazole-3-carbonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[1-[3-[4-[(dimethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,2,4-triazole-3-carbonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166208546 |
| Molecular Formula | C18H18F3N7O3 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1-[1-[3-[4-[(dimethylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]ethyl]-1,2,4-triazole-3-carbonitrile;2,2,2-trifluoroacetic acid |
| SMILES | CC(c1nc(-c2ccc(CN(C)C)cc2)no1)n1cnc(C#N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H17N7O.C2HF3O2/c1-11(23-10-18-14(8-17)20-23)16-19-15(21-24-16)13-6-4-12(5-7-13)9-22(2)3;3-2(4,5)1(6)7/h4-7,10-11H,9H2,1-3H3;(H,6,7) |
| InChIKey | MVRGHZDPTBOYFT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |