C18H23ClN2O3 — CID 166222335
N-[2-[[3-(4-chlorophenyl)cyclobutyl]amino]-2-oxoethyl]oxane-4-carboxamide (PubChem CID 166222335) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is N-[2-[[3-(4-chlorophenyl)cyclobutyl]amino]-2-oxoethyl]oxane-4-carboxamide.
| Compound Name | N-[2-[[3-(4-chlorophenyl)cyclobutyl]amino]-2-oxoethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 166222335 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[2-[[3-(4-chlorophenyl)cyclobutyl]amino]-2-oxoethyl]oxane-4-carboxamide |
| SMILES | O=C(CNC(=O)C1CCOCC1)NC1CC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H23ClN2O3/c19-15-3-1-12(2-4-15)14-9-16(10-14)21-17(22)11-20-18(23)13-5-7-24-8-6-13/h1-4,13-14,16H,5-11H2,(H,20,23)(H,21,22) |
| InChIKey | GJKPYSZXDGIYPK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |