C12H20N2O5S — CID 112993782
N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide (PubChem CID 112993782) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide.
| Compound Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 112993782 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide |
| SMILES | O=C(CNC(=O)C1CCOCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O5S/c15-11(14-10-3-6-20(17,18)8-10)7-13-12(16)9-1-4-19-5-2-9/h9-10H,1-8H2,(H,13,16)(H,14,15) |
| InChIKey | VQAQISVBGCDZRT-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |