About N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide
N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide (PubChem CID 112993782) has the molecular formula C12H20N2O5S
and a molecular weight of 304.37 g/mol. Its IUPAC name is N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide |
| PubChem CID | 112993782 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide |
| SMILES | O=C(CNC(=O)C1CCOCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O5S/c15-11(14-10-3-6-20(17,18)8-10)7-13-12(16)9-1-4-19-5-2-9/h9-10H,1-8H2,(H,13,16)(H,14,15) |
| InChIKey | VQAQISVBGCDZRT-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide?
The IUPAC name of N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide (CID 112993782) is N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide.
What is the SMILES notation for N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide?
The canonical SMILES for N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide is O=C(CNC(=O)C1CCOCC1)NC1CCS(=O)(=O)C1.
What is the InChIKey of N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide?
The InChIKey is VQAQISVBGCDZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O5S/c15-11(14-10-3-6-20(17,18)8-10)7-13-12(16)9-1-4-19-5-2-9/h9-10H,1-8H2,(H,13,16)(H,14,15).
What are the key properties of N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide?
N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide has a molecular weight of 304.37 g/mol, XLogP of -1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]oxane-4-carboxamide is sourced from PubChem (CID 112993782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).