C23H31FN4O3 — CID 166223443
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide (PubChem CID 166223443) has the molecular formula C23H31FN4O3 and a molecular weight of 430.52 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 166223443 |
| Molecular Formula | C23H31FN4O3 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-fluoro-4-[(4-methylpiperazin-1-yl)methyl]phenyl]propanamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)CCN3C(=O)C4CCCCC4C3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C23H31FN4O3/c1-26-10-12-27(13-11-26)15-16-6-7-20(19(24)14-16)25-21(29)8-9-28-22(30)17-4-2-3-5-18(17)23(28)31/h6-7,14,17-18H,2-5,8-13,15H2,1H3,(H,25,29) |
| InChIKey | NZOQARLFJNNULD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|