C14H8BrNO2S — CID 166225100
(E)-1-(5-bromo-1-benzofuran-2-yl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one (PubChem CID 166225100) has the molecular formula C14H8BrNO2S and a molecular weight of 334.19 g/mol. Its IUPAC name is (E)-1-(5-bromo-1-benzofuran-2-yl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-bromo-1-benzofuran-2-yl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 166225100 |
| Molecular Formula | C14H8BrNO2S |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 332.95 |
| IUPAC Name | (E)-1-(5-bromo-1-benzofuran-2-yl)-3-(1,3-thiazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cncs1)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C14H8BrNO2S/c15-10-1-4-13-9(5-10)6-14(18-13)12(17)3-2-11-7-16-8-19-11/h1-8H/b3-2+ |
| InChIKey | RSMZCLFFFVZQCJ-NSCUHMNNSA-N |
| XLogP | 4.55 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|