C16H17FN4O4 — CID 166225265
methyl 2-[[4-fluoro-2-[(3-methylimidazole-4-carbonyl)amino]benzoyl]amino]propanoate (PubChem CID 166225265) has the molecular formula C16H17FN4O4 and a molecular weight of 348.33 g/mol. Its IUPAC name is methyl 2-[[4-fluoro-2-[(3-methylimidazole-4-carbonyl)amino]benzoyl]amino]propanoate.
| Compound Name | methyl 2-[[4-fluoro-2-[(3-methylimidazole-4-carbonyl)amino]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 166225265 |
| Molecular Formula | C16H17FN4O4 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | methyl 2-[[4-fluoro-2-[(3-methylimidazole-4-carbonyl)amino]benzoyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)c1ccc(F)cc1NC(=O)c1cncn1C |
| InChI | InChI=1S/C16H17FN4O4/c1-9(16(24)25-3)19-14(22)11-5-4-10(17)6-12(11)20-15(23)13-7-18-8-21(13)2/h4-9H,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | NWNXTMCIJYVWBT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |