C19H30N4O4S — CID 16622876
3-(cyclohexylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]propanamide (PubChem CID 16622876) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-(cyclohexylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]propanamide.
| Compound Name | 3-(cyclohexylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 16622876 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-(cyclohexylcarbamoylamino)-N-[[2-(dimethylsulfamoyl)phenyl]methyl]propanamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1CNC(=O)CCNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H30N4O4S/c1-23(2)28(26,27)17-11-7-6-8-15(17)14-21-18(24)12-13-20-19(25)22-16-9-4-3-5-10-16/h6-8,11,16H,3-5,9-10,12-14H2,1-2H3,(H,21,24)(H2,20,22,25) |
| InChIKey | KNDJDOONDSLDDC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |