C17H27N3O3S — CID 41468178
1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1R,2R)-2-methylcyclohexyl]urea (PubChem CID 41468178) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1R,2R)-2-methylcyclohexyl]urea.
| Compound Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1R,2R)-2-methylcyclohexyl]urea |
|---|---|
| PubChem CID | 41468178 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 1-[[2-(dimethylsulfamoyl)phenyl]methyl]-3-[(1R,2R)-2-methylcyclohexyl]urea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)NCc1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C17H27N3O3S/c1-13-8-4-6-10-15(13)19-17(21)18-12-14-9-5-7-11-16(14)24(22,23)20(2)3/h5,7,9,11,13,15H,4,6,8,10,12H2,1-3H3,(H2,18,19,21)/t13-,15-/m1/s1 |
| InChIKey | MHYQCFRMDDKNKD-UKRRQHHQSA-N |
| XLogP | 2.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |