C24H25F5N6O4 — CID 166234170
N'-[2-(difluoromethyl)-3H-benzimidazol-5-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid (PubChem CID 166234170) has the molecular formula C24H25F5N6O4 and a molecular weight of 556.49 g/mol. Its IUPAC name is N'-[2-(difluoromethyl)-3H-benzimidazol-5-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-[2-(difluoromethyl)-3H-benzimidazol-5-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166234170 |
| Molecular Formula | C24H25F5N6O4 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | N'-[2-(difluoromethyl)-3H-benzimidazol-5-yl]-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]oxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2ccc3nc(C(F)F)[nH]c3c2)ccc1N1CCN(C)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H24F2N6O2.C2HF3O2/c1-13-11-14(4-6-18(13)30-9-7-29(2)8-10-30)25-21(31)22(32)26-15-3-5-16-17(12-15)28-20(27-16)19(23)24;3-2(4,5)1(6)7/h3-6,11-12,19H,7-10H2,1-2H3,(H,25,31)(H,26,32)(H,27,28);(H,6,7) |
| InChIKey | JKHSDHDJPFUCCT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|