C13H17ClO4S — CID 166237619
(3-chloro-4-methylphenyl) oxan-3-ylmethanesulfonate (PubChem CID 166237619) has the molecular formula C13H17ClO4S and a molecular weight of 304.80 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl) oxan-3-ylmethanesulfonate.
| Compound Name | (3-chloro-4-methylphenyl) oxan-3-ylmethanesulfonate |
|---|---|
| PubChem CID | 166237619 |
| Molecular Formula | C13H17ClO4S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (3-chloro-4-methylphenyl) oxan-3-ylmethanesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)CC2CCCOC2)cc1Cl |
| InChI | InChI=1S/C13H17ClO4S/c1-10-4-5-12(7-13(10)14)18-19(15,16)9-11-3-2-6-17-8-11/h4-5,7,11H,2-3,6,8-9H2,1H3 |
| InChIKey | FIMYHZCEKGJODX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|