C21H29N3O3 — CID 166247218
1-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 166247218) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | 1-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 166247218 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[[3-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methylamino]-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | COc1cc(CNCC(O)CN2CCCC2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C21H29N3O3/c1-26-21-11-17(12-23-14-19(25)15-24-9-2-3-10-24)6-7-20(21)27-16-18-5-4-8-22-13-18/h4-8,11,13,19,23,25H,2-3,9-10,12,14-16H2,1H3 |
| InChIKey | AMEZNIRTWLSDMP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |