C15H13N3O3S — CID 166249191
N-(3-cyanophenoxy)-2-(oxolan-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 166249191) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is N-(3-cyanophenoxy)-2-(oxolan-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-cyanophenoxy)-2-(oxolan-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166249191 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(3-cyanophenoxy)-2-(oxolan-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | N#Cc1cccc(ONC(=O)c2csc(C3CCCO3)n2)c1 |
| InChI | InChI=1S/C15H13N3O3S/c16-8-10-3-1-4-11(7-10)21-18-14(19)12-9-22-15(17-12)13-5-2-6-20-13/h1,3-4,7,9,13H,2,5-6H2,(H,18,19) |
| InChIKey | NMVVCWIEXOCXTH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|