About N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide
N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide (PubChem CID 97244097) has the molecular formula C15H13ClN4O2S
and a molecular weight of 348.82 g/mol. Its IUPAC name is N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 97244097 |
| Molecular Formula | C15H13ClN4O2S |
| Molecular Weight | 348.82 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1n[nH]c2c(Cl)cccc12)c1csc([C@H]2CCCO2)n1 |
| InChI | InChI=1S/C15H13ClN4O2S/c16-9-4-1-3-8-12(9)19-20-13(8)18-14(21)10-7-23-15(17-10)11-5-2-6-22-11/h1,3-4,7,11H,2,5-6H2,(H2,18,19,20,21)/t11-/m1/s1 |
| InChIKey | OQDBRCYVFDGJMG-LLVKDONJSA-N |
| XLogP | 3.78 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.82 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide (CID 97244097) is N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide is O=C(Nc1n[nH]c2c(Cl)cccc12)c1csc([C@H]2CCCO2)n1.
What is the InChIKey of N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide?
The InChIKey is OQDBRCYVFDGJMG-LLVKDONJSA-N. The full InChI is InChI=1S/C15H13ClN4O2S/c16-9-4-1-3-8-12(9)19-20-13(8)18-14(21)10-7-23-15(17-10)11-5-2-6-22-11/h1,3-4,7,11H,2,5-6H2,(H2,18,19,20,21)/t11-/m1/s1.
What are the key properties of N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide?
N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide has a molecular weight of 348.82 g/mol, XLogP of 3.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-chloro-1H-indazol-3-yl)-2-[(2R)-oxolan-2-yl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 97244097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).