C19H24N6O — CID 166254401
2-(cyclobutylamino)-N-(1-pyridazin-3-ylpiperidin-4-yl)pyridine-4-carboxamide (PubChem CID 166254401) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(cyclobutylamino)-N-(1-pyridazin-3-ylpiperidin-4-yl)pyridine-4-carboxamide.
| Compound Name | 2-(cyclobutylamino)-N-(1-pyridazin-3-ylpiperidin-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166254401 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-(cyclobutylamino)-N-(1-pyridazin-3-ylpiperidin-4-yl)pyridine-4-carboxamide |
| SMILES | O=C(NC1CCN(c2cccnn2)CC1)c1ccnc(NC2CCC2)c1 |
| InChI | InChI=1S/C19H24N6O/c26-19(14-6-10-20-17(13-14)22-15-3-1-4-15)23-16-7-11-25(12-8-16)18-5-2-9-21-24-18/h2,5-6,9-10,13,15-16H,1,3-4,7-8,11-12H2,(H,20,22)(H,23,26) |
| InChIKey | MAVIKZYLEIQPOF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |