C19H33N7O — CID 166257233
2,6-bis(4-ethyl-1,4-diazepan-1-yl)pyrimidine-4-carboxamide (PubChem CID 166257233) has the molecular formula C19H33N7O and a molecular weight of 375.52 g/mol. Its IUPAC name is 2,6-bis(4-ethyl-1,4-diazepan-1-yl)pyrimidine-4-carboxamide.
| Compound Name | 2,6-bis(4-ethyl-1,4-diazepan-1-yl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166257233 |
| Molecular Formula | C19H33N7O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 2,6-bis(4-ethyl-1,4-diazepan-1-yl)pyrimidine-4-carboxamide |
| SMILES | CCN1CCCN(c2cc(C(N)=O)nc(N3CCCN(CC)CC3)n2)CC1 |
| InChI | InChI=1S/C19H33N7O/c1-3-23-7-5-9-25(13-11-23)17-15-16(18(20)27)21-19(22-17)26-10-6-8-24(4-2)12-14-26/h15H,3-14H2,1-2H3,(H2,20,27) |
| InChIKey | MQSNPMNMSFOQBO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |