C13H15F3N2O3 — CID 166258109
methyl (3S)-3-[[2-[6-(trifluoromethyl)-3-pyridinyl]acetyl]amino]butanoate (PubChem CID 166258109) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is methyl (3S)-3-[[2-[6-(trifluoromethyl)-3-pyridinyl]acetyl]amino]butanoate.
| Compound Name | methyl (3S)-3-[[2-[6-(trifluoromethyl)-3-pyridinyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 166258109 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | methyl (3S)-3-[[2-[6-(trifluoromethyl)-3-pyridinyl]acetyl]amino]butanoate |
| SMILES | COC(=O)C[C@H](C)NC(=O)Cc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-8(5-12(20)21-2)18-11(19)6-9-3-4-10(17-7-9)13(14,15)16/h3-4,7-8H,5-6H2,1-2H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | IAJJEKSDHLZXIA-QMMMGPOBSA-N |
| XLogP | 1.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |