C12H12ClNO3S — CID 166260142
5-[[(4-chlorothiophen-2-yl)methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 166260142) has the molecular formula C12H12ClNO3S and a molecular weight of 285.75 g/mol. Its IUPAC name is 5-[[(4-chlorothiophen-2-yl)methylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[(4-chlorothiophen-2-yl)methylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 166260142 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 5-[[(4-chlorothiophen-2-yl)methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(CNCc2cc(Cl)cs2)cc1C(=O)O |
| InChI | InChI=1S/C12H12ClNO3S/c1-7-11(12(15)16)3-9(17-7)4-14-5-10-2-8(13)6-18-10/h2-3,6,14H,4-5H2,1H3,(H,15,16) |
| InChIKey | WCCZCILDYOQOCW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |