C23H23ClN2O2 — CID 166265825
N-[[1-(3-chlorophenyl)cyclohexyl]methyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 166265825) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is N-[[1-(3-chlorophenyl)cyclohexyl]methyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[[1-(3-chlorophenyl)cyclohexyl]methyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 166265825 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[[1-(3-chlorophenyl)cyclohexyl]methyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(NCC1(c2cccc(Cl)c2)CCCCC1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H23ClN2O2/c24-17-8-6-7-16(13-17)23(11-4-1-5-12-23)15-25-22(28)19-14-21(27)26-20-10-3-2-9-18(19)20/h2-3,6-10,13-14H,1,4-5,11-12,15H2,(H,25,28)(H,26,27) |
| InChIKey | OZAVEQYIUYBXRJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |