C13H16F2N2O4S — CID 166266002
3-[(4,4-difluoropiperidin-1-yl)sulfonylamino]-5-methylbenzoic acid (PubChem CID 166266002) has the molecular formula C13H16F2N2O4S and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-[(4,4-difluoropiperidin-1-yl)sulfonylamino]-5-methylbenzoic acid.
| Compound Name | 3-[(4,4-difluoropiperidin-1-yl)sulfonylamino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 166266002 |
| Molecular Formula | C13H16F2N2O4S |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 3-[(4,4-difluoropiperidin-1-yl)sulfonylamino]-5-methylbenzoic acid |
| SMILES | Cc1cc(NS(=O)(=O)N2CCC(F)(F)CC2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H16F2N2O4S/c1-9-6-10(12(18)19)8-11(7-9)16-22(20,21)17-4-2-13(14,15)3-5-17/h6-8,16H,2-5H2,1H3,(H,18,19) |
| InChIKey | ATXKEURJSPSDLD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |