C18H20N4O3 — CID 166270131
(2-cyclopropylpyrimidin-5-yl)methyl 3-(phenylcarbamoylamino)propanoate (PubChem CID 166270131) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2-cyclopropylpyrimidin-5-yl)methyl 3-(phenylcarbamoylamino)propanoate.
| Compound Name | (2-cyclopropylpyrimidin-5-yl)methyl 3-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 166270131 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2-cyclopropylpyrimidin-5-yl)methyl 3-(phenylcarbamoylamino)propanoate |
| SMILES | O=C(NCCC(=O)OCc1cnc(C2CC2)nc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N4O3/c23-16(8-9-19-18(24)22-15-4-2-1-3-5-15)25-12-13-10-20-17(21-11-13)14-6-7-14/h1-5,10-11,14H,6-9,12H2,(H2,19,22,24) |
| InChIKey | CIODSOAGPRAUPV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |