About 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine
4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine (PubChem CID 166283862) has the molecular formula C16H19N5
and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine.
Molecular Properties
| Compound Name | 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine |
| PubChem CID | 166283862 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine |
| SMILES | Cc1cccc2[nH]c(NCc3c4c(nn3C)CCC4)nc12 |
| InChI | InChI=1S/C16H19N5/c1-10-5-3-8-13-15(10)19-16(18-13)17-9-14-11-6-4-7-12(11)20-21(14)2/h3,5,8H,4,6-7,9H2,1-2H3,(H2,17,18,19) |
| InChIKey | FNAIYRSKNZGTQO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine?
The IUPAC name of 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine (CID 166283862) is 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine.
What is the SMILES notation for 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine?
The canonical SMILES for 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine is Cc1cccc2[nH]c(NCc3c4c(nn3C)CCC4)nc12.
What is the InChIKey of 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine?
The InChIKey is FNAIYRSKNZGTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5/c1-10-5-3-8-13-15(10)19-16(18-13)17-9-14-11-6-4-7-12(11)20-21(14)2/h3,5,8H,4,6-7,9H2,1-2H3,(H2,17,18,19).
What are the key properties of 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine?
4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine has a molecular weight of 281.36 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazol-3-yl)methyl]-1H-benzimidazol-2-amine is sourced from PubChem (CID 166283862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).