About 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate
2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate (PubChem CID 166283987) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate |
| PubChem CID | 166283987 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate |
| SMILES | CCCCCCOCCOC(=O)C1(c2ccncc2)CC1 |
| InChI | InChI=1S/C17H25NO3/c1-2-3-4-5-12-20-13-14-21-16(19)17(8-9-17)15-6-10-18-11-7-15/h6-7,10-11H,2-5,8-9,12-14H2,1H3 |
| InChIKey | AGWPPHHOPIBCRG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate?
The IUPAC name of 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate (CID 166283987) is 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate.
What is the SMILES notation for 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate?
The canonical SMILES for 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate is CCCCCCOCCOC(=O)C1(c2ccncc2)CC1.
What is the InChIKey of 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate?
The InChIKey is AGWPPHHOPIBCRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-2-3-4-5-12-20-13-14-21-16(19)17(8-9-17)15-6-10-18-11-7-15/h6-7,10-11H,2-5,8-9,12-14H2,1H3.
What are the key properties of 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate?
2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate has a molecular weight of 291.39 g/mol, XLogP of 3.25, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexoxyethyl 1-pyridin-4-ylcyclopropane-1-carboxylate is sourced from PubChem (CID 166283987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).