C19H25N5O — CID 166287209
[(4aS,7aS)-1-(6-propan-2-ylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 166287209) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is [(4aS,7aS)-1-(6-propan-2-ylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(4aS,7aS)-1-(6-propan-2-ylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 166287209 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | [(4aS,7aS)-1-(6-propan-2-ylpyrimidin-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | CC(C)c1cc(N2CCC[C@H]3CN(C(=O)c4ccc[nH]4)C[C@H]32)ncn1 |
| InChI | InChI=1S/C19H25N5O/c1-13(2)16-9-18(22-12-21-16)24-8-4-5-14-10-23(11-17(14)24)19(25)15-6-3-7-20-15/h3,6-7,9,12-14,17,20H,4-5,8,10-11H2,1-2H3/t14-,17+/m0/s1 |
| InChIKey | IUZBWVWGAONYHJ-WMLDXEAASA-N |
| XLogP | 2.67 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |