C15H17ClN2O2 — CID 166288620
3-[(5-chloro-1H-indol-2-yl)methyl-cyclopropylamino]propanoic acid (PubChem CID 166288620) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is 3-[(5-chloro-1H-indol-2-yl)methyl-cyclopropylamino]propanoic acid.
| Compound Name | 3-[(5-chloro-1H-indol-2-yl)methyl-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 166288620 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-[(5-chloro-1H-indol-2-yl)methyl-cyclopropylamino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1cc2cc(Cl)ccc2[nH]1)C1CC1 |
| InChI | InChI=1S/C15H17ClN2O2/c16-11-1-4-14-10(7-11)8-12(17-14)9-18(13-2-3-13)6-5-15(19)20/h1,4,7-8,13,17H,2-3,5-6,9H2,(H,19,20) |
| InChIKey | YCIXYJQIWJDTRY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |