C16H19NO5S — CID 166290515
(1R,6S)-6-(3,4-dihydro-1H-isochromen-7-ylsulfonylamino)cyclohex-3-ene-1-carboxylic acid (PubChem CID 166290515) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is (1R,6S)-6-(3,4-dihydro-1H-isochromen-7-ylsulfonylamino)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1R,6S)-6-(3,4-dihydro-1H-isochromen-7-ylsulfonylamino)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 166290515 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (1R,6S)-6-(3,4-dihydro-1H-isochromen-7-ylsulfonylamino)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC=CC[C@@H]1NS(=O)(=O)c1ccc2c(c1)COCC2 |
| InChI | InChI=1S/C16H19NO5S/c18-16(19)14-3-1-2-4-15(14)17-23(20,21)13-6-5-11-7-8-22-10-12(11)9-13/h1-2,5-6,9,14-15,17H,3-4,7-8,10H2,(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | USZFXTXUPAZXMF-CABCVRRESA-N |
| XLogP | 1.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|