C17H23NO3S — CID 136528429
N-(2-cyclohexylcyclopropyl)-1,3-dihydro-2-benzofuran-5-sulfonamide (PubChem CID 136528429) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is N-(2-cyclohexylcyclopropyl)-1,3-dihydro-2-benzofuran-5-sulfonamide.
| Compound Name | N-(2-cyclohexylcyclopropyl)-1,3-dihydro-2-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 136528429 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-(2-cyclohexylcyclopropyl)-1,3-dihydro-2-benzofuran-5-sulfonamide |
| SMILES | O=S(=O)(NC1CC1C1CCCCC1)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C17H23NO3S/c19-22(20,15-7-6-13-10-21-11-14(13)8-15)18-17-9-16(17)12-4-2-1-3-5-12/h6-8,12,16-18H,1-5,9-11H2 |
| InChIKey | JETDQFZXMMMCRT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |